| product Name |
Fioricet |
| CAS No |
122018-95-5 |
| Synonyms |
Acetaminophen mixture with butalbital and caffeine; Acetaminophen mixture with caffeine and butalbital; Acetaminophen, butalbital and caffeine; Acetaminophen, butalbital, and caffeine; Alagesic; Amaphen; Americet; Anolor; Anoquan; Arcet; Butace; Butalbital, APAP, and caffeine; Butalbital, acetaminophen and caffeine; Endolor; Esgic; Esgic Plus; Esgic-Plus; Ezol; Femcet; Medigesic Plus; Pacaps; Repan; Tencet; Zebutal; Acetamide, N-(4-hydroxyphenyl)-, mixt. with 3,7-dihydro-1,3,7-trimethyl-1H-purine-2,6-dione and 5-(2-methylpropyl)-5-(2-propenyl)-2,4,6(1H,3H,5H)-pyrimidinetrione; 5-allyl-5-isobutyl-hexahydropyrimidine-2,4,6-trione; N-(4-hydroxyphenyl)acetamide; 1,3,7-trimethylpurine-2,6-dione |
| Molecular Formula |
C27H35N7O7 |
| Molecular Weight |
569.6095 |
| InChI |
InChI=1/C11H16N2O3.C8H10N4O2.C8H9NO2/c1-4-5-11(6-7(2)3)8(14)12-10(16)13-9(11)15;1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2;1-6(10)9-7-2-4-8(11)5-3-7/h4,7H,1,5-6H2,2-3H3,(H2,12,13,14,15,16);4H,1-3H3;2-5,11H,1H3,(H,9,10) |
| Molecular Structure |
|
| Boiling point |
805°C at 760 mmHg |
| Flash point |
440.7°C |
| Vapour Pressur |
5.84E-27mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
