ChemNet > CAS > 127657-97-0 Benzyloxyacetaldehyde dimethyl acetal
127657-97-0 Benzyloxyacetaldehyde dimethyl acetal
| product Name |
Benzyloxyacetaldehyde dimethyl acetal |
| CAS No |
127657-97-0 |
| Synonyms |
2-Benzyloxy-1,1-dimethoxyethane; [(2,2-dimethoxyethoxy)methyl]benzene |
| Molecular Formula |
C11H16O3 |
| Molecular Weight |
196.2429 |
| InChI |
InChI=1/C11H16O3/c1-12-11(13-2)9-14-8-10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.026g/cm3 |
| Boiling point |
252.7°C at 760 mmHg |
| Refractive index |
1.485 |
| Flash point |
94.2°C |
| Vapour Pressur |
0.0303mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
