ChemNet > CAS > 129619-37-0 (3R,6R)-3,6-Octanediol
129619-37-0 (3R,6R)-3,6-Octanediol
| product Name |
(3R,6R)-3,6-Octanediol |
| CAS No |
129619-37-0 |
| Synonyms |
(3R,6R)-Dihydroxyoctane; (3R,6R)-octane-3,6-diol |
| Molecular Formula |
C8H18O2 |
| Molecular Weight |
146.2273 |
| InChI |
InChI=1/C8H18O2/c1-3-7(9)5-6-8(10)4-2/h7-10H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| Molecular Structure |
|
| Density |
0.935g/cm3 |
| Boiling point |
240.8°C at 760 mmHg |
| Refractive index |
1.45 |
| Flash point |
124.5°C |
| Vapour Pressur |
0.00645mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
