ChemNet > CAS > 13048-99-2 Glycine n-butyl ester hydrochloride
13048-99-2 Glycine n-butyl ester hydrochloride
| product Name |
Glycine n-butyl ester hydrochloride |
| CAS No |
13048-99-2 |
| Synonyms |
n-Butyl glycinate hydrochloride~H-Gly-OBu.HCl; Glycinen-butylesterhydrochloride; butyl glycinate; butyl glycinate hydrochloride (1:1) |
| Molecular Formula |
C6H14ClNO2 |
| Molecular Weight |
167.6339 |
| InChI |
InChI=1/C6H13NO2.ClH/c1-2-3-4-9-6(8)5-7;/h2-5,7H2,1H3;1H |
| EINECS |
235-924-5 |
| Molecular Structure |
|
| Boiling point |
159.1°C at 760 mmHg |
| Flash point |
33.3°C |
| Vapour Pressur |
2.55mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
