ChemNet > CAS > 13072-69-0 N-(1-Adamantyl)urea
13072-69-0 N-(1-Adamantyl)urea
| product Name |
N-(1-Adamantyl)urea |
| CAS No |
13072-69-0 |
| Molecular Formula |
C11H18N2O |
| Molecular Weight |
194.2734 |
| InChI |
InChI=1/C11H18N2O/c12-10(14)13-11-4-7-1-8(5-11)3-9(2-7)6-11/h7-9H,1-6H2,(H3,12,13,14) |
| EINECS |
235-965-9 |
| Molecular Structure |
|
| Density |
1.17g/cm3 |
| Melting point |
250℃ |
| Boiling point |
309.5°C at 760 mmHg |
| Refractive index |
1.57 |
| Flash point |
141°C |
| Vapour Pressur |
0.000639mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
