ChemNet > CAS > 13074-65-2 Hexylcyclopentanone; 98%
13074-65-2 Hexylcyclopentanone; 98%
| product Name |
Hexylcyclopentanone; 98% |
| CAS No |
13074-65-2 |
| Synonyms |
2-n-Hexylcyclopentanone; 2-hexylcyclopentanone |
| Molecular Formula |
C11H20O |
| Molecular Weight |
168.2759 |
| InChI |
InChI=1/C11H20O/c1-2-3-4-5-7-10-8-6-9-11(10)12/h10H,2-9H2,1H3 |
| EINECS |
235-970-6 |
| Molecular Structure |
|
| Density |
0.891g/cm3 |
| Boiling point |
234.9°C at 760 mmHg |
| Refractive index |
1.453 |
| Flash point |
88.6°C |
| Vapour Pressur |
0.0517mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
