ChemNet > CAS > 13078-04-1 DL-Anabasine
13078-04-1 DL-Anabasine
| product Name |
DL-Anabasine |
| CAS No |
13078-04-1 |
| Synonyms |
2-Pyridin-3-ylpiperidine; Neonicotine~2-(3-Pyridyl)piperidine; 3-piperidin-2-ylpyridine; 3-(piperidin-2-yl)pyridine hydrochloride (1:1); 3-(2-piperidyl)pyridine; 3-(piperidin-2-yl)pyridine |
| Molecular Formula |
C10H14N2 |
| Molecular Weight |
162.2316 |
| InChI |
InChI=1/C10H14N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8,10,12H,1-2,5,7H2 |
| EINECS |
207-791-3 |
| Molecular Structure |
|
| Density |
1.014g/cm3 |
| Melting point |
9℃ |
| Boiling point |
271°C at 760 mmHg |
| Refractive index |
1.524 |
| Flash point |
93.3°C |
| Vapour Pressur |
0.00662mmHg at 25°C |
| Hazard Symbols |
 T:Toxic;
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
