ChemNet > CAS > 13078-13-2 1-(3-Methylphenyl)piperazine dihydrochloride
13078-13-2 1-(3-Methylphenyl)piperazine dihydrochloride
| product Name |
1-(3-Methylphenyl)piperazine dihydrochloride |
| CAS No |
13078-13-2 |
| Synonyms |
1-(m-Tolyl)piperazine dihydrochloride; 1-(m-Tolyl)piperazine hydrochloride; N-(3-Methylphenyl)piperazine dihydrochloride; 4-(3-methylphenyl)piperazin-1-ium |
| Molecular Formula |
C11H17N2 |
| Molecular Weight |
177.2655 |
| InChI |
InChI=1/C11H16N2/c1-10-3-2-4-11(9-10)13-7-5-12-6-8-13/h2-4,9,12H,5-8H2,1H3/p+1 |
| EINECS |
235-974-8 |
| Molecular Structure |
|
| Melting point |
195-202℃ |
| Boiling point |
321.4°C at 760 mmHg |
| Flash point |
154°C |
| Vapour Pressur |
0.000299mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
