ChemNet > CAS > 13078-14-3 1-(4-Methylphenyl)piperazine dihydrochloride
13078-14-3 1-(4-Methylphenyl)piperazine dihydrochloride
| product Name |
1-(4-Methylphenyl)piperazine dihydrochloride |
| CAS No |
13078-14-3 |
| Synonyms |
1-(p-Tolyl)piperazine dihydrochloride; N-(4-Methylphenyl)piperazine dihydrochloride |
| Molecular Formula |
C11H18Cl2N2 |
| Molecular Weight |
249.18 |
| InChI |
InChI=1/C11H16N2.2ClH/c1-10-2-4-11(5-3-10)13-8-6-12-7-9-13;;/h2-5,12H,6-9H2,1H3;2*1H |
| EINECS |
235-975-3 |
| Molecular Structure |
|
| Melting point |
214℃ |
| Boiling point |
321.2°C at 760 mmHg |
| Flash point |
153.8°C |
| Vapour Pressur |
0.000303mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
