ChemNet > CAS > 13080-90-5 5-norbornen-2-ol
13080-90-5 5-norbornen-2-ol
| product Name |
5-norbornen-2-ol |
| CAS No |
13080-90-5 |
| Synonyms |
5-Norbornen-2-ol,mixture of endo and exo; 5-Norbornen-2-ol, mixture of endo and exo; bicyclo[2.2.1]hept-5-en-2-ol; 5-NORBORNENE-2-OL; BICYCLO[2.2.1]HEPT-5-ENE-2-OL; 3,6-ENDOMETHYLENE-1,2,3,6-TETRAHYDROPHENOL |
| Molecular Formula |
C7H10O |
| Molecular Weight |
110.1537 |
| InChI |
InChI=1/C7H10O/c8-7-4-5-1-2-6(7)3-5/h1-2,5-8H,3-4H2 |
| EINECS |
235-987-9 |
| Molecular Structure |
|
| Density |
1.153g/cm3 |
| Boiling point |
183.7°C at 760 mmHg |
| Refractive index |
1.574 |
| Flash point |
62°C |
| Vapour Pressur |
0.218mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
| MSDS |
Material Safety Data Sheet
|
|
