ChemNet > CAS > 13118-04-2 N,N'-o-Phenylenedimaleimide
13118-04-2 N,N'-o-Phenylenedimaleimide
| product Name |
N,N'-o-Phenylenedimaleimide |
| CAS No |
13118-04-2 |
| Synonyms |
1,2-Phenylene-bis-maleimide; 1,1'-benzene-1,2-diylbis(1H-pyrrole-2,5-dione) |
| Molecular Formula |
C14H8N2O4 |
| Molecular Weight |
268.2243 |
| InChI |
InChI=1/C14H8N2O4/c17-11-5-6-12(18)15(11)9-3-1-2-4-10(9)16-13(19)7-8-14(16)20/h1-8H |
| EINECS |
236-046-5 |
| Molecular Structure |
|
| Density |
1.567g/cm3 |
| Melting point |
245-248℃ |
| Boiling point |
459.7°C at 760 mmHg |
| Refractive index |
1.703 |
| Flash point |
223.7°C |
| Vapour Pressur |
1.24E-08mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
