ChemNet > CAS > 131738-73-3 1-Bromo-3-isopropoxybenzene
131738-73-3 1-Bromo-3-isopropoxybenzene
| product Name |
1-Bromo-3-isopropoxybenzene |
| CAS No |
131738-73-3 |
| Synonyms |
2-(3-Bromophenoxy)propane~3-Bromophenyl isopropyl ether; 3-Bromophenyl isopropyl ether; 1-bromo-3-(1-methylethoxy)benzene |
| Molecular Formula |
C9H11BrO |
| Molecular Weight |
215.087 |
| InChI |
InChI=1/C9H11BrO/c1-7(2)11-9-5-3-4-8(10)6-9/h3-7H,1-2H3 |
| Molecular Structure |
|
| Density |
1.319g/cm3 |
| Boiling point |
232°C at 760 mmHg |
| Refractive index |
1.523 |
| Flash point |
104.2°C |
| Vapour Pressur |
0.0919mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
