ChemNet > CAS > 1319-88-6 5-hydroxy-2-phenyl-1,3-dioxane
1319-88-6 5-hydroxy-2-phenyl-1,3-dioxane
| product Name |
5-hydroxy-2-phenyl-1,3-dioxane |
| CAS No |
1319-88-6 |
| Synonyms |
Benzaldehyde, cyclic acetal with 1,2,3-propanetriol; Benzal glyceral acetal; Benzaldehyde 1,2,3-propanetriol cyclic acetal; Benzaldehyde glycerol cyclic acetal; Benzaldehyde glyceryl acetal; Benzaldehyde glyceryl acetal (natural); Benzaldehyde, cyclic acetal with glycerol; Benzalglycerin; Benzylideneglycerol; FEMA No. 2129; 5-Hydroxy-2-phenyl-1,3-dioxane; 2-phenyl-1,3-dioxan-5-ol; (3Z)-4-phenylbut-3-ene-1,2,3-triol |
| Molecular Formula |
C10H12O3 |
| Molecular Weight |
180.2005 |
| InChI |
InChI=1/C10H12O3/c11-7-10(13)9(12)6-8-4-2-1-3-5-8/h1-6,10-13H,7H2/b9-6- |
| EINECS |
215-294-8 |
| Molecular Structure |
|
| Density |
1.29g/cm3 |
| Boiling point |
427°C at 760 mmHg |
| Refractive index |
1.654 |
| Flash point |
217.9°C |
| Vapour Pressur |
4.74E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
