ChemNet > CAS > 132274-70-5 1-phenyl-1H-pyrazole-5-carbaldehyde
132274-70-5 1-phenyl-1H-pyrazole-5-carbaldehyde
| product Name |
1-phenyl-1H-pyrazole-5-carbaldehyde |
| CAS No |
132274-70-5 |
| Molecular Formula |
C10H8N2O |
| Molecular Weight |
172.1833 |
| InChI |
InChI=1/C10H8N2O/c13-8-10-6-7-11-12(10)9-4-2-1-3-5-9/h1-8H |
| Molecular Structure |
|
| Density |
1.15g/cm3 |
| Boiling point |
312.7°C at 760 mmHg |
| Refractive index |
1.604 |
| Flash point |
142.9°C |
| Vapour Pressur |
0.00052mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
