13228-39-2 N-Ethyl-2-phenylindole
product Name |
N-Ethyl-2-phenylindole |
CAS No |
13228-39-2 |
Synonyms |
1-Ethyl-2-phenylindole; 1-ethyl-2-phenyl-1H-indole |
Molecular Formula |
C16H15N |
Molecular Weight |
221.297 |
InChI |
InChI=1/C16H15N/c1-2-17-15-11-7-6-10-14(15)12-16(17)13-8-4-3-5-9-13/h3-12H,2H2,1H3 |
EINECS |
236-199-8 |
Molecular Structure |
|
Density |
1.03g/cm3 |
Boiling point |
390.6°C at 760 mmHg |
Refractive index |
1.59 |
Flash point |
190°C |
Vapour Pressur |
5.91E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|