| product Name |
1,6-Anhydro-beta-D-glucose-2,3,4-tri-O-acetate |
| CAS No |
13242-55-2 |
| Synonyms |
1,6-anhydro-B-D-glucose 2,3,4-*triacetate; 1,6-Anhydro-2,3,4-tri-O-acetyl--D-glucopyranose; 6,8-dioxabicyclo[3.2.1]octane-2,3,4-triyl triacetate (non-preferred name); (1S,2R,3S,4R,5S)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triyl triacetate (non-preferred name); (1R,2R,3S,4R,5R)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triyl triacetate (non-preferred name) |
| Molecular Formula |
C12H16O8 |
| Molecular Weight |
288.2506 |
| InChI |
InChI=1/C12H16O8/c1-5(13)17-9-8-4-16-12(20-8)11(19-7(3)15)10(9)18-6(2)14/h8-12H,4H2,1-3H3/t8-,9-,10+,11-,12-/m1/s1 |
| EINECS |
236-222-1 |
| Molecular Structure |
|
| Density |
1.344g/cm3 |
| Melting point |
111℃ |
| Boiling point |
392°C at 760 mmHg |
| Refractive index |
1.494 |
| Flash point |
147.326°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
