ChemNet > CAS > 132546-81-7 methyl 6-morpholinonicotinate
132546-81-7 methyl 6-morpholinonicotinate
| product Name |
methyl 6-morpholinonicotinate |
| CAS No |
132546-81-7 |
| Synonyms |
methyl 6-morpholin-4-ylpyridine-3-carboxylate |
| Molecular Formula |
C11H14N2O3 |
| Molecular Weight |
222.2405 |
| InChI |
InChI=1/C11H14N2O3/c1-15-11(14)9-2-3-10(12-8-9)13-4-6-16-7-5-13/h2-3,8H,4-7H2,1H3 |
| Molecular Structure |
|
| Density |
1.208g/cm3 |
| Melting point |
109℃ |
| Boiling point |
383.6°C at 760 mmHg |
| Refractive index |
1.542 |
| Flash point |
185.8°C |
| Vapour Pressur |
4.36E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
