ChemNet > CAS > 132898-95-4 2,2'-bithiophene-5-boronic acid
132898-95-4 2,2'-bithiophene-5-boronic acid
| product Name |
2,2'-bithiophene-5-boronic acid |
| CAS No |
132898-95-4 |
| Synonyms |
2,2'-bithiophen-5-ylboronic acid |
| Molecular Formula |
C8H7BO2S2 |
| Molecular Weight |
210.081 |
| InChI |
InChI=1/C8H7BO2S2/c10-9(11)8-4-3-7(13-8)6-2-1-5-12-6/h1-5,10-11H |
| Molecular Structure |
|
| Density |
1.42g/cm3 |
| Melting point |
127℃ |
| Boiling point |
416.1°C at 760 mmHg |
| Refractive index |
1.658 |
| Flash point |
205.5°C |
| Vapour Pressur |
1.14E-07mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
