ChemNet > CAS > 132980-99-5 3,5-difluorobenzamide
132980-99-5 3,5-difluorobenzamide
| product Name |
3,5-difluorobenzamide |
| CAS No |
132980-99-5 |
| Synonyms |
Difluorobenzamide6 |
| Molecular Formula |
C7H5F2NO |
| Molecular Weight |
157.1175 |
| InChI |
InChI=1/C7H5F2NO/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H2,10,11) |
| Molecular Structure |
|
| Density |
1.348g/cm3 |
| Melting point |
155-157℃ |
| Boiling point |
187.7°C at 760 mmHg |
| Refractive index |
1.515 |
| Flash point |
67.3°C |
| Vapour Pressur |
0.622mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
