ChemNet > CAS > 133082-13-0 (S)-(+)-1-(2-chlorophenyl)-1,2-ethanediol
133082-13-0 (S)-(+)-1-(2-chlorophenyl)-1,2-ethanediol
| product Name |
(S)-(+)-1-(2-chlorophenyl)-1,2-ethanediol |
| CAS No |
133082-13-0 |
| Synonyms |
(1S)-1-(2-Chlorophenyl)ethane-1,2-diol |
| Molecular Formula |
C8H9ClO2 |
| Molecular Weight |
172.6089 |
| InChI |
InChI=1/C8H9ClO2/c9-7-4-2-1-3-6(7)8(11)5-10/h1-4,8,10-11H,5H2/t8-/m1/s1 |
| Molecular Structure |
|
| Density |
1.328g/cm3 |
| Melting point |
68-75℃ |
| Boiling point |
322°C at 760 mmHg |
| Refractive index |
1.588 |
| Flash point |
148.5°C |
| Vapour Pressur |
0.000119mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
