ChemNet > CAS > 13311-52-9 4-(2-Pyridylazo)resorcinol monosodium salt hydrate
13311-52-9 4-(2-Pyridylazo)resorcinol monosodium salt hydrate
| product Name |
4-(2-Pyridylazo)resorcinol monosodium salt hydrate |
| Synonyms |
sodium (6E)-3-oxo-6-[2-(pyridin-2-yl)hydrazinylidene]cyclohexa-1,4-dien-1-olate |
| Molecular Formula |
C11H8N3NaO2 |
| Molecular Weight |
237.1899 |
| InChI |
InChI=1/C11H9N3O2.Na/c15-8-4-5-9(10(16)7-8)13-14-11-3-1-2-6-12-11;/h1-7,16H,(H,12,14);/q;+1/p-1/b13-9+; |
| CAS Registry Number |
13311-52-9 |
| EINECS |
236-339-8 |
| Molecular Structure |
|
| Boiling point |
399.2°C at 760 mmHg |
| Flash point |
195.3°C |
| Vapour Pressur |
4.32E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
