ChemNet > CAS > 13321-74-9 1-bromo-2,5-dimethoxy-4-methylbenzene
13321-74-9 1-bromo-2,5-dimethoxy-4-methylbenzene
| product Name |
1-bromo-2,5-dimethoxy-4-methylbenzene |
| CAS No |
13321-74-9 |
| Molecular Formula |
C9H11BrO2 |
| Molecular Weight |
231.0864 |
| InChI |
InChI=1/C9H11BrO2/c1-6-4-9(12-3)7(10)5-8(6)11-2/h4-5H,1-3H3 |
| Molecular Structure |
|
| Density |
1.36g/cm3 |
| Melting point |
77℃ |
| Boiling point |
270.4°C at 760 mmHg |
| Refractive index |
1.525 |
| Flash point |
114.1°C |
| Vapour Pressur |
0.0114mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
