ChemNet > CAS > 13327-27-0 6-Methylpyridazin-3(2H)-one
13327-27-0 6-Methylpyridazin-3(2H)-one
| product Name |
6-Methylpyridazin-3(2H)-one |
| CAS No |
13327-27-0 |
| Synonyms |
6-Methyl-3(2H)-pyridazinone; 6-Methylpyridazin-3-one;
; 6-methylpyridazin-3-ol; 6-Methyl-2H-pyridazin-3-one |
| Molecular Formula |
C5H6N2O |
| Molecular Weight |
110.1139 |
| InChI |
InChI=1/C5H6N2O/c1-4-2-3-5(8)7-6-4/h2-3H,1H3,(H,7,8) |
| EINECS |
236-367-0 |
| Molecular Structure |
|
| Density |
1.22g/cm3 |
| Boiling point |
310.3°C at 760 mmHg |
| Refractive index |
1.576 |
| Flash point |
141.5°C |
| Vapour Pressur |
0.000331mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
