ChemNet > CAS > 13365-26-9 Dimethyl 3-nitrophthalate
13365-26-9 Dimethyl 3-nitrophthalate
| product Name |
Dimethyl 3-nitrophthalate |
| CAS No |
13365-26-9 |
| Synonyms |
3-Nitrophthalic acid dimethyl ester; dimethyl 3-nitrobenzene-1,2-dicarboxylate |
| Molecular Formula |
C10H9NO6 |
| Molecular Weight |
239.1816 |
| InChI |
InChI=1/C10H9NO6/c1-16-9(12)6-4-3-5-7(11(14)15)8(6)10(13)17-2/h3-5H,1-2H3 |
| Molecular Structure |
|
| Density |
1.35g/cm3 |
| Boiling point |
314.6°C at 760 mmHg |
| Refractive index |
1.549 |
| Flash point |
134.3°C |
| Vapour Pressur |
0.000462mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
