ChemNet > CAS > 13388-75-5 3,5-Dimethoxyphenylacetonitrile
13388-75-5 3,5-Dimethoxyphenylacetonitrile
| product Name |
3,5-Dimethoxyphenylacetonitrile |
| CAS No |
13388-75-5 |
| Molecular Formula |
C10H11NO2 |
| Molecular Weight |
177.1998 |
| InChI |
InChI=1/C10H11NO2/c1-12-9-5-8(3-4-11)6-10(7-9)13-2/h5-7H,3H2,1-2H3 |
| EINECS |
202-225-1 |
| Molecular Structure |
|
| Density |
1.082g/cm3 |
| Boiling point |
316.7°C at 760 mmHg |
| Refractive index |
1.511 |
| Flash point |
127.3°C |
| Vapour Pressur |
0.000404mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
