ChemNet > CAS > 13431-34-0 4-Ethyl-3-thiosemicarbazide
13431-34-0 4-Ethyl-3-thiosemicarbazide
| product Name |
4-Ethyl-3-thiosemicarbazide |
| CAS No |
13431-34-0 |
| Molecular Formula |
C3H9N3S |
| Molecular Weight |
119.1887 |
| InChI |
InChI=1/C3H9N3S/c1-2-5-3(7)6-4/h2,4H2,1H3,(H2,5,6,7) |
| EINECS |
236-553-1 |
| Molecular Structure |
|
| Density |
1.142g/cm3 |
| Melting point |
80-85℃ |
| Boiling point |
187.4°C at 760 mmHg |
| Refractive index |
1.564 |
| Flash point |
67.2°C |
| Vapour Pressur |
0.63mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
