ChemNet > CAS > 13461-74-0 9-Ethynyl-9-fluorenol
13461-74-0 9-Ethynyl-9-fluorenol
| product Name |
9-Ethynyl-9-fluorenol |
| CAS No |
13461-74-0 |
| Synonyms |
9-ethynyl-9H-fluoren-9-ol |
| Molecular Formula |
C15H10O |
| Molecular Weight |
206.2393 |
| InChI |
InChI=1/C15H10O/c1-2-15(16)13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h1,3-10,16H |
| Molecular Structure |
|
| Density |
1.26g/cm3 |
| Boiling point |
375.2°C at 760 mmHg |
| Refractive index |
1.695 |
| Flash point |
178.1°C |
| Vapour Pressur |
2.69E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
