ChemNet > CAS > 135159-25-0 2,4,6-Trimethoxybenzeneboronic acid
135159-25-0 2,4,6-Trimethoxybenzeneboronic acid
| product Name |
2,4,6-Trimethoxybenzeneboronic acid |
| CAS No |
135159-25-0 |
| Synonyms |
2,4,6-Trimethoxyphenylboronic acid |
| Molecular Formula |
C9H13BO5 |
| Molecular Weight |
212.0075 |
| InChI |
InChI=1/C9H13BO5/c1-13-6-4-7(14-2)9(10(11)12)8(5-6)15-3/h4-5,11-12H,1-3H3 |
| Molecular Structure |
|
| Density |
1.21g/cm3 |
| Boiling point |
413.8°C at 760 mmHg |
| Refractive index |
1.513 |
| Flash point |
204.1°C |
| Vapour Pressur |
1.37E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
