ChemNet > CAS > 135306-45-5 3,5-difluoropropiophenone
135306-45-5 3,5-difluoropropiophenone
| product Name |
3,5-difluoropropiophenone |
| CAS No |
135306-45-5 |
| Synonyms |
1-(3,5-difluorophenyl)propan-1-one; 1-(3,5-difluorophenyl)propan-2-one |
| Molecular Formula |
C9H8F2O |
| Molecular Weight |
170.156 |
| InChI |
InChI=1/C9H8F2O/c1-6(12)2-7-3-8(10)5-9(11)4-7/h3-5H,2H2,1H3 |
| Molecular Structure |
|
| Density |
1.179g/cm3 |
| Melting point |
25-27℃ |
| Boiling point |
191.5°C at 760 mmHg |
| Refractive index |
1.472 |
| Flash point |
70.6°C |
| Vapour Pressur |
0.513mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
