ChemNet > CAS > 13608-87-2 2',3',4'-Trichloroacetophenone
13608-87-2 2',3',4'-Trichloroacetophenone
| product Name |
2',3',4'-Trichloroacetophenone |
| CAS No |
13608-87-2 |
| Synonyms |
1-(2,3,4-Trichlorophenyl)ethanone; 2,3,4-Trichloroacetophenone |
| Molecular Formula |
C8H5Cl3O |
| Molecular Weight |
223.4837 |
| InChI |
InChI=1/C8H5Cl3O/c1-4(12)5-2-3-6(9)8(11)7(5)10/h2-3H,1H3 |
| EINECS |
237-092-9 |
| Molecular Structure |
|
| Density |
1.425g/cm3 |
| Melting point |
59-64℃ |
| Boiling point |
297.5°C at 760 mmHg |
| Refractive index |
1.563 |
| Flash point |
124.5°C |
| Vapour Pressur |
0.00134mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
