ChemNet > CAS > 136099-52-0 2-(Bromomethyl)-1-methyl-1H-benzimidazole
136099-52-0 2-(Bromomethyl)-1-methyl-1H-benzimidazole
| product Name |
2-(Bromomethyl)-1-methyl-1H-benzimidazole |
| CAS No |
136099-52-0 |
| Molecular Formula |
C9H9BrN2 |
| Molecular Weight |
225.0852 |
| InChI |
InChI=1/C9H9BrN2/c1-12-8-5-3-2-4-7(8)11-9(12)6-10/h2-5H,6H2,1H3 |
| Molecular Structure |
|
| Density |
1.52g/cm3 |
| Boiling point |
337°C at 760 mmHg |
| Refractive index |
1.642 |
| Flash point |
157.6°C |
| Vapour Pressur |
0.000211mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
