ChemNet > CAS > 13629-22-6 9-Fluorenone hydrazone
13629-22-6 9-Fluorenone hydrazone
| product Name |
9-Fluorenone hydrazone |
| CAS No |
13629-22-6 |
| Synonyms |
Fluorenone hydrazone
; 9H-Fluoren-9-one hydrazone; 9H-fluoren-9-ylidenehydrazine |
| Molecular Formula |
C13H10N2 |
| Molecular Weight |
194.2319 |
| InChI |
InChI=1/C13H10N2/c14-15-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8H,14H2 |
| EINECS |
237-116-8 |
| Molecular Structure |
|
| Density |
1.23g/cm3 |
| Melting point |
149-150℃ |
| Boiling point |
362.5°C at 760 mmHg |
| Refractive index |
1.682 |
| Flash point |
173°C |
| Vapour Pressur |
1.93E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
