ChemNet > CAS > 13679-72-6 2-acetyl-3-methylthiophene
13679-72-6 2-acetyl-3-methylthiophene
| product Name |
2-acetyl-3-methylthiophene |
| CAS No |
13679-72-6 |
| Synonyms |
1-(3-methylthiophen-2-yl)ethanone; 2-acetyl-3-methyl thiophene |
| Molecular Formula |
C7H8OS |
| Molecular Weight |
140.2028 |
| InChI |
InChI=1/C7H8OS/c1-5-3-4-9-7(5)6(2)8/h3-4H,1-2H3 |
| EINECS |
237-179-1 |
| Molecular Structure |
|
| Density |
1.106g/cm3 |
| Boiling point |
214.9°C at 760 mmHg |
| Refractive index |
1.535 |
| Flash point |
92.3°C |
| Vapour Pressur |
0.152mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
|
