ChemNet > CAS > 13692-14-3 Alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol
13692-14-3 Alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol
| product Name |
Alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol |
| CAS No |
13692-14-3 |
| Synonyms |
alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol; 2-chloro-1-(2,4-dichlorophenyl)ethanol; (1S)-2-chloro-1-(2,4-dichlorophenyl)ethanol; (1R)-2-chloro-1-(2,4-dichlorophenyl)ethanol |
| Molecular Formula |
C8H7Cl3O |
| Molecular Weight |
225.4996 |
| InChI |
InChI=1/C8H7Cl3O/c9-4-8(12)6-2-1-5(10)3-7(6)11/h1-3,8,12H,4H2/t8-/m0/s1 |
| EINECS |
237-206-7 |
| Molecular Structure |
|
| Density |
1.447g/cm3 |
| Melting point |
48-52℃ |
| Boiling point |
323.3°C at 760 mmHg |
| Refractive index |
1.581 |
| Flash point |
149.3°C |
| Vapour Pressur |
0.000109mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
