ChemNet > CAS > 13720-06-4 2,6-Dibromonaphthalene
13720-06-4 2,6-Dibromonaphthalene
| product Name |
2,6-Dibromonaphthalene |
| CAS No |
13720-06-4 |
| Molecular Formula |
C10H6Br2 |
| Molecular Weight |
285.9626 |
| InChI |
InChI=1/C10H6Br2/c11-9-3-1-7-5-10(12)4-2-8(7)6-9/h1-6H |
| Molecular Structure |
|
| Density |
1.834g/cm3 |
| Boiling point |
339.1°C at 760 mmHg |
| Refractive index |
1.688 |
| Flash point |
184.7°C |
| Vapour Pressur |
0.000184mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
