13720-06-4 2,6-Dibromonaphthalene
product Name |
2,6-Dibromonaphthalene |
CAS No |
13720-06-4 |
Molecular Formula |
C10H6Br2 |
Molecular Weight |
285.9626 |
InChI |
InChI=1/C10H6Br2/c11-9-3-1-7-5-10(12)4-2-8(7)6-9/h1-6H |
Molecular Structure |
|
Density |
1.834g/cm3 |
Boiling point |
339.1°C at 760 mmHg |
Refractive index |
1.688 |
Flash point |
184.7°C |
Vapour Pressur |
0.000184mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|