ChemNet > CAS > 13735-12-1 6-Chlorothiochroman-4-one
13735-12-1 6-Chlorothiochroman-4-one
| product Name |
6-Chlorothiochroman-4-one |
| Synonyms |
6-Chloro-3,4-dihydro-2H-1-benzothiin-4-one; 6-chloro-2,3-dihydro-4H-thiochromen-4-one |
| Molecular Formula |
C9H7ClOS |
| Molecular Weight |
198.6693 |
| InChI |
InChI=1/C9H7ClOS/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-2,5H,3-4H2 |
| CAS Registry Number |
13735-12-1 |
| Molecular Structure |
|
| Density |
1.377g/cm3 |
| Melting point |
64℃ |
| Boiling point |
342.7°C at 760 mmHg |
| Refractive index |
1.634 |
| Flash point |
161.1°C |
| Vapour Pressur |
7.39E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
6-Chlorothiochroman-4-one Material Safety Data Sheet
|
|
