ChemNet > CAS > 13816-33-6 4-Isopropylbenzonitrile
13816-33-6 4-Isopropylbenzonitrile
| product Name |
4-Isopropylbenzonitrile |
| CAS No |
13816-33-6 |
| Synonyms |
4-Cyanocumene; 4-(propan-2-yl)benzonitrile |
| Molecular Formula |
C10H11N |
| Molecular Weight |
145.201 |
| InChI |
InChI=1/C10H11N/c1-8(2)10-5-3-9(7-11)4-6-10/h3-6,8H,1-2H3 |
| EINECS |
237-492-3 |
| Molecular Structure |
|
| Density |
0.96g/cm3 |
| Boiling point |
231.5°C at 760 mmHg |
| Refractive index |
1.515 |
| Flash point |
93.6°C |
| Vapour Pressur |
0.0623mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
