ChemNet > CAS > 13894-63-8 Methyl trans-2-hexenoate
13894-63-8 Methyl trans-2-hexenoate
| product Name |
Methyl trans-2-hexenoate |
| CAS No |
13894-63-8 |
| Synonyms |
237-663-2; 2-Hexenoic acid, methyl ester, (E)-; 4U1VO1 & & E Form; Hex-2-enoic acid methyl ester, (E)-; Methyl (2E)-2-hexenoate; Methyl (2E)-hex-2-enoate; Methyl (E)-2-hexenoate |
| Molecular Formula |
C7H12O2 |
| Molecular Weight |
128.169 |
| InChI |
InChI=1/C7H12O2/c1-3-4-5-6-7(8)9-2/h5-6H,3-4H2,1-2H3/b6-5+ |
| EINECS |
237-663-2 |
| Molecular Structure |
|
| Density |
0.907g/cm3 |
| Boiling point |
149.3°C at 760 mmHg |
| Refractive index |
1.427 |
| Flash point |
45.4°C |
| Vapour Pressur |
4.06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
