ChemNet > CAS > 13979-81-2 3,5-Dibromo-4-methylphenol
13979-81-2 3,5-Dibromo-4-methylphenol
| product Name |
3,5-Dibromo-4-methylphenol |
| CAS No |
13979-81-2 |
| Synonyms |
3,5-Dibromo-p-cresol (OH=1); 3,5-Dibromo-p-cresol |
| Molecular Formula |
C7H6Br2O |
| Molecular Weight |
265.9299 |
| InChI |
InChI=1/C7H6Br2O/c1-4-6(8)2-5(10)3-7(4)9/h2-3,10H,1H3 |
| EINECS |
237-763-6 |
| Molecular Structure |
|
| Density |
1.948g/cm3 |
| Boiling point |
293.1°C at 760 mmHg |
| Refractive index |
1.626 |
| Flash point |
131.1°C |
| Vapour Pressur |
0.00101mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
