ChemNet > CAS > 14003-34-0 3-Methyl-2-quinoxalinol
14003-34-0 3-Methyl-2-quinoxalinol
| product Name |
3-Methyl-2-quinoxalinol |
| CAS No |
14003-34-0 |
| Synonyms |
3-Methyl-2(1H)-quinoxalinone; 3-methylquinoxalin-2(1H)-one |
| Molecular Formula |
C9H8N2O |
| Molecular Weight |
160.1726 |
| InChI |
InChI=1/C9H8N2O/c1-6-9(12)11-8-5-3-2-4-7(8)10-6/h2-5H,1H3,(H,11,12) |
| EINECS |
237-807-4 |
| Molecular Structure |
|
| Density |
1.26g/cm3 |
| Melting point |
246-248℃ |
| Boiling point |
345.6°C at 760 mmHg |
| Refractive index |
1.644 |
| Flash point |
162.8°C |
| Vapour Pressur |
3.04E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
