ChemNet > CAS > 14064-83-6 4-Hydroxy-4'-nitrostilbene
14064-83-6 4-Hydroxy-4'-nitrostilbene
| product Name |
4-Hydroxy-4'-nitrostilbene |
| CAS No |
14064-83-6 |
| Synonyms |
4-[2-(Nitrophenyl)ethenyl]phenol; 4-[2-(4-nitrophenyl)ethenyl]phenol; 4-[(E)-2-(4-nitrophenyl)ethenyl]phenol |
| Molecular Formula |
C14H11NO3 |
| Molecular Weight |
241.242 |
| InChI |
InChI=1/C14H11NO3/c16-14-9-5-12(6-10-14)2-1-11-3-7-13(8-4-11)15(17)18/h1-10,16H/b2-1+ |
| Molecular Structure |
|
| Density |
1.318g/cm3 |
| Boiling point |
389.8°C at 760 mmHg |
| Refractive index |
1.717 |
| Flash point |
164.5°C |
| Vapour Pressur |
1.23E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
