ChemNet > CAS > 14065-32-8 methyl 10-chloro-10-oxodecanoate
14065-32-8 methyl 10-chloro-10-oxodecanoate
| product Name |
methyl 10-chloro-10-oxodecanoate |
| CAS No |
14065-32-8 |
| Synonyms |
Methyl sebacoyl chloride; Sebacinic acid monomethylester monochloride |
| Molecular Formula |
C11H19ClO3 |
| Molecular Weight |
234.7198 |
| InChI |
InChI=1/C11H19ClO3/c1-15-11(14)9-7-5-3-2-4-6-8-10(12)13/h2-9H2,1H3 |
| Molecular Structure |
|
| Density |
1.056g/cm3 |
| Boiling point |
286.3°C at 760 mmHg |
| Refractive index |
1.449 |
| Flash point |
102.4°C |
| Vapour Pressur |
0.00266mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
