ChemNet > CAS > 14073-97-3 l-Menthone
14073-97-3 l-Menthone
| product Name |
l-Menthone |
| CAS No |
14073-97-3 |
| Synonyms |
(-)-5-Methyl-2-(1-methylethyl)cyclohexanone; Menthone Laevo Natural; (-)-menthan-3-one; (2S,5R)-5-methyl-2-(propan-2-yl)cyclohexanone |
| Molecular Formula |
C10H18O |
| Molecular Weight |
154.2493 |
| InChI |
InChI=1/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-9H,4-6H2,1-3H3/t8-,9+/m1/s1 |
| EINECS |
237-926-1 |
| Molecular Structure |
|
| Density |
0.881g/cm3 |
| Boiling point |
205°C at 760 mmHg |
| Refractive index |
1.442 |
| Flash point |
72.8°C |
| Vapour Pressur |
0.256mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
