14090-87-0 2,4-Octanedione
product Name |
2,4-Octanedione |
CAS No |
14090-87-0 |
Synonyms |
Octane-2,4-dione |
Molecular Formula |
C8H14O2 |
Molecular Weight |
142.1956 |
InChI |
InChI=1/C8H14O2/c1-3-4-5-8(10)6-7(2)9/h3-6H2,1-2H3 |
EINECS |
237-937-1 |
Molecular Structure |
|
Density |
0.918g/cm3 |
Boiling point |
204.1°C at 760 mmHg |
Refractive index |
1.419 |
Flash point |
72.5°C |
Vapour Pressur |
0.268mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|