ChemNet > CAS > 141-79-7 Mesityl oxide, mixture of alpha- and beta-isomers
141-79-7 Mesityl oxide, mixture of alpha- and beta-isomers
| product Name |
Mesityl oxide, mixture of alpha- and beta-isomers |
| Synonyms |
4-Methyl-3-penten-2-one; Methyl isobutenyl ketone; Mesityl oxide; Isopropylidene acetone; 4-methylpent-3-en-2-one; MO; 2-Methyl-2-Penten-4-One |
| Molecular Formula |
C6H10O |
| Molecular Weight |
98.143 |
| InChI |
InChI=1/C6H10O/c1-5(2)4-6(3)7/h4H,1-3H3 |
| CAS Registry Number |
141-79-7 |
| EINECS |
205-502-5 |
| Molecular Structure |
|
| Density |
0.83g/cm3 |
| Melting point |
-53℃ |
| Boiling point |
132.7°C at 760 mmHg |
| Refractive index |
1.418 |
| Flash point |
30.6°C |
| Water solubility |
28 g/L (20℃) |
| Vapour Pressur |
8.76mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R10:;
R20/21/22:;
|
| Safety Description |
S25:;
|
| MSDS |
Mesityl oxide, mixture of alpha- and beta-isomers Material Safety Data Sheet
|
|
