ChemNet > CAS > 141042-56-0 (2S,3S)-(+)-Diethyl 2,3-O-benzylidenetartrate
141042-56-0 (2S,3S)-(+)-Diethyl 2,3-O-benzylidenetartrate
| product Name |
(2S,3S)-(+)-Diethyl 2,3-O-benzylidenetartrate |
| CAS No |
141042-56-0 |
| Synonyms |
(2S,3S)-(+)-2,3-O-Benzylidenetartaric acid diethyl ester; diethyl 2-phenyl-1,3-dioxolane-4,5-dicarboxylate; diethyl (4S,5S)-2-phenyl-1,3-dioxolane-4,5-dicarboxylate |
| Molecular Formula |
C15H18O6 |
| Molecular Weight |
294.2998 |
| InChI |
InChI=1/C15H18O6/c1-3-18-13(16)11-12(14(17)19-4-2)21-15(20-11)10-8-6-5-7-9-10/h5-9,11-12,15H,3-4H2,1-2H3/t11-,12-/m0/s1 |
| Molecular Structure |
|
| Density |
1.209g/cm3 |
| Boiling point |
385.1°C at 760 mmHg |
| Refractive index |
1.509 |
| Flash point |
168.7°C |
| Vapour Pressur |
3.89E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
