ChemNet > CAS > 14123-60-5 3-Chlorophenylacetone
14123-60-5 3-Chlorophenylacetone
| product Name |
3-Chlorophenylacetone |
| CAS No |
14123-60-5 |
| Synonyms |
1-(3-chlorophenyl)propan-2-one |
| Molecular Formula |
C9H9ClO |
| Molecular Weight |
168.6202 |
| InChI |
InChI=1/C9H9ClO/c1-7(11)5-8-3-2-4-9(10)6-8/h2-4,6H,5H2,1H3 |
| Molecular Structure |
|
| Density |
1.141g/cm3 |
| Boiling point |
236.542°C at 760 mmHg |
| Refractive index |
1.526 |
| Flash point |
116.264°C |
| Vapour Pressur |
0.047mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
