ChemNet > CAS > 1416-03-1 Tannins, compds. with (R)-3-hydroxy-α-[(methylamino)methyl]benzenemethanol
1416-03-1 Tannins, compds. with (R)-3-hydroxy-α-[(methylamino)methyl]benzenemethanol
| product Name |
Tannins, compds. with (R)-3-hydroxy-α-[(methylamino)methyl]benzenemethanol |
| CAS No |
1416-03-1 |
| Synonyms |
Tannins, compds. with (R)-3-hydroxy-alpha-((methylamino)methyl)benzenemethanol; UNII-DU5ATO7HYP; 3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol |
| Molecular Formula |
C9H13NO2 |
| Molecular Weight |
167.205 |
| InChI |
InChI=1/C9H13NO2/c1-10-6-9(12)7-3-2-4-8(11)5-7/h2-5,9-12H,6H2,1H3/t9-/m0/s1 |
| EINECS |
215-810-1 |
| Molecular Structure |
![1416-03-1 Tannins, compds. with (R)-3-hydroxy-α-[(methylamino)methyl]benzenemethanol](https://images-a.chemnet.com/suppliers/chembase/cas3/cas1416-03-1.gif)
|
| Density |
1.159g/cm3 |
| Boiling point |
341.1°C at 760 mmHg |
| Refractive index |
1.571 |
| Flash point |
163.4°C |
| Vapour Pressur |
3.18E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
