ChemNet > CAS > 14210-25-4 5-Chloro-1-phenyl-1H-tetrazole
14210-25-4 5-Chloro-1-phenyl-1H-tetrazole
| product Name |
5-Chloro-1-phenyl-1H-tetrazole |
| CAS No |
14210-25-4 |
| Synonyms |
5-Chloro-1-phenyltetrazole |
| Molecular Formula |
C7H5ClN4 |
| Molecular Weight |
180.5944 |
| InChI |
InChI=1/C7H5ClN4/c8-7-9-10-11-12(7)6-4-2-1-3-5-6/h1-5H |
| EINECS |
238-065-4 |
| Molecular Structure |
|
| Density |
1.47g/cm3 |
| Melting point |
120-125℃ |
| Boiling point |
335.8°C at 760 mmHg |
| Refractive index |
1.702 |
| Flash point |
156.9°C |
| Vapour Pressur |
0.000117mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
